C14H25BO3 — CID 54146376
(4R,5R)-4,5-dicyclohexyl-2-hydroxy-1,3,2-dioxaborolane (PubChem CID 54146376) has the molecular formula C14H25BO3 and a molecular weight of 252.16 g/mol. Its IUPAC name is (4R,5R)-4,5-dicyclohexyl-2-hydroxy-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-dicyclohexyl-2-hydroxy-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 54146376 |
| Molecular Formula | C14H25BO3 |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (4R,5R)-4,5-dicyclohexyl-2-hydroxy-1,3,2-dioxaborolane |
| SMILES | OB1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C14H25BO3/c16-15-17-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h11-14,16H,1-10H2/t13-,14-/m1/s1 |
| InChIKey | OEQZMTBWKXVRSB-ZIAGYGMSSA-N |
| XLogP | 2.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|