C18H24 — CID 54146449
1,2,3,4,4a,4b,5,6,6a,7,8,9-dodecahydrochrysene (PubChem CID 54146449) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1,2,3,4,4a,4b,5,6,6a,7,8,9-dodecahydrochrysene.
| Compound Name | 1,2,3,4,4a,4b,5,6,6a,7,8,9-dodecahydrochrysene |
|---|---|
| PubChem CID | 54146449 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 1,2,3,4,4a,4b,5,6,6a,7,8,9-dodecahydrochrysene |
| SMILES | C1=C2C3=CC=C4CCCCC4C3CCC2CCC1 |
| InChI | InChI=1S/C18H24/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h7,10,12-13,16,18H,1-6,8-9,11H2 |
| InChIKey | OESCMXNUUMGAIU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |