About 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol
2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol (PubChem CID 54147321) has the molecular formula C10H18N2O2S
and a molecular weight of 230.33 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol |
| PubChem CID | 54147321 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol |
| SMILES | Cc1csc(C(O)COCCN(C)C)n1 |
| InChI | InChI=1S/C10H18N2O2S/c1-8-7-15-10(11-8)9(13)6-14-5-4-12(2)3/h7,9,13H,4-6H2,1-3H3 |
| InChIKey | OFHPEVQVEZYMGF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol?
The IUPAC name of 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol (CID 54147321) is 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol.
What is the SMILES notation for 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol?
The canonical SMILES for 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol is Cc1csc(C(O)COCCN(C)C)n1.
What is the InChIKey of 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol?
The InChIKey is OFHPEVQVEZYMGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2S/c1-8-7-15-10(11-8)9(13)6-14-5-4-12(2)3/h7,9,13H,4-6H2,1-3H3.
What are the key properties of 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol?
2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol has a molecular weight of 230.33 g/mol, XLogP of 1.06, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)ethoxy]-1-(4-methyl-1,3-thiazol-2-yl)ethanol is sourced from PubChem (CID 54147321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).