C12H25NO2S — CID 54147463
tert-butyl 2-[(2S)-2-amino-4-methylpentyl]sulfanylacetate (PubChem CID 54147463) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-2-amino-4-methylpentyl]sulfanylacetate.
| Compound Name | tert-butyl 2-[(2S)-2-amino-4-methylpentyl]sulfanylacetate |
|---|---|
| PubChem CID | 54147463 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | tert-butyl 2-[(2S)-2-amino-4-methylpentyl]sulfanylacetate |
| SMILES | CC(C)C[C@H](N)CSCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO2S/c1-9(2)6-10(13)7-16-8-11(14)15-12(3,4)5/h9-10H,6-8,13H2,1-5H3/t10-/m0/s1 |
| InChIKey | OFKBLDBHJHWFRL-JTQLQIEISA-N |
| XLogP | 2.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |