ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate

C8H14F2N2O2 — CID 54147579

IUPACethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate
SMILESCCOC(=O)C(N)(C=CCN)C(F)F
InChIInChI=1S/C8H14F2N2O2/c1-2-14-7(13)8(12,6(9)10)4-3-5-11/h3-4,6H,2,5,11-12H2,1H3
InChIKeyOFMARRLMDGQRON-UHFFFAOYSA-N
MW208.21 g/mol
LogP0.03
Rot. Bonds5

About ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate

ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate (PubChem CID 54147579) has the molecular formula C8H14F2N2O2 and a molecular weight of 208.21 g/mol. Its IUPAC name is ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate.

Molecular Properties

Compound Nameethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate
PubChem CID54147579
Molecular FormulaC8H14F2N2O2
Molecular Weight208.21 g/mol
Exact Mass208.10
IUPAC Nameethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate
SMILESCCOC(=O)C(N)(C=CCN)C(F)F
InChIInChI=1S/C8H14F2N2O2/c1-2-14-7(13)8(12,6(9)10)4-3-5-11/h3-4,6H,2,5,11-12H2,1H3
InChIKeyOFMARRLMDGQRON-UHFFFAOYSA-N
XLogP0.03
TPSA78.34 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.21
LogP ≤ 50.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate?
The IUPAC name of ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate (CID 54147579) is ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate.
What is the SMILES notation for ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate?
The canonical SMILES for ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate is CCOC(=O)C(N)(C=CCN)C(F)F.
What is the InChIKey of ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate?
The InChIKey is OFMARRLMDGQRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O2/c1-2-14-7(13)8(12,6(9)10)4-3-5-11/h3-4,6H,2,5,11-12H2,1H3.
What are the key properties of ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate?
ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate has a molecular weight of 208.21 g/mol, XLogP of 0.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,5-diamino-2-(difluoromethyl)pent-3-enoate is sourced from PubChem (CID 54147579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).