About [(3,5-dimethyladamantane-1-carbonyl)amino]urea
[(3,5-dimethyladamantane-1-carbonyl)amino]urea (PubChem CID 541477) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is [(3,5-dimethyladamantane-1-carbonyl)amino]urea.
Molecular Properties
| Compound Name | [(3,5-dimethyladamantane-1-carbonyl)amino]urea |
| PubChem CID | 541477 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | [(3,5-dimethyladamantane-1-carbonyl)amino]urea |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)NNC(N)=O)(C3)C2 |
| InChI | InChI=1S/C14H23N3O2/c1-12-3-9-4-13(2,6-12)8-14(5-9,7-12)10(18)16-17-11(15)19/h9H,3-8H2,1-2H3,(H,16,18)(H3,15,17,19) |
| InChIKey | WXOVAVXCJROWQY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3,5-dimethyladamantane-1-carbonyl)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5-dimethyladamantane-1-carbonyl)amino]urea?
The IUPAC name of [(3,5-dimethyladamantane-1-carbonyl)amino]urea (CID 541477) is [(3,5-dimethyladamantane-1-carbonyl)amino]urea.
What is the SMILES notation for [(3,5-dimethyladamantane-1-carbonyl)amino]urea?
The canonical SMILES for [(3,5-dimethyladamantane-1-carbonyl)amino]urea is CC12CC3CC(C)(C1)CC(C(=O)NNC(N)=O)(C3)C2.
What is the InChIKey of [(3,5-dimethyladamantane-1-carbonyl)amino]urea?
The InChIKey is WXOVAVXCJROWQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-12-3-9-4-13(2,6-12)8-14(5-9,7-12)10(18)16-17-11(15)19/h9H,3-8H2,1-2H3,(H,16,18)(H3,15,17,19).
What are the key properties of [(3,5-dimethyladamantane-1-carbonyl)amino]urea?
[(3,5-dimethyladamantane-1-carbonyl)amino]urea has a molecular weight of 265.36 g/mol, XLogP of 1.68, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5-dimethyladamantane-1-carbonyl)amino]urea is sourced from PubChem (CID 541477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).