C46H45N2O+ — CID 54148757
2-[3-[5-methoxy-3,3-dimethyl-1-(3-phenylprop-2-enyl)indol-2-ylidene]prop-1-enyl]-1,1-dimethyl-3-(3-phenylprop-2-enyl)benzo[e]indol-3-ium (PubChem CID 54148757) has the molecular formula C46H45N2O+ and a molecular weight of 641.88 g/mol. Its IUPAC name is 2-[3-[5-methoxy-3,3-dimethyl-1-(3-phenylprop-2-enyl)indol-2-ylidene]prop-1-enyl]-1,1-dimethyl-3-(3-phenylprop-2-enyl)benzo[e]indol-3-ium.
| Compound Name | 2-[3-[5-methoxy-3,3-dimethyl-1-(3-phenylprop-2-enyl)indol-2-ylidene]prop-1-enyl]-1,1-dimethyl-3-(3-phenylprop-2-enyl)benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 54148757 |
| Molecular Formula | C46H45N2O+ |
| Molecular Weight | 641.88 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | 2-[3-[5-methoxy-3,3-dimethyl-1-(3-phenylprop-2-enyl)indol-2-ylidene]prop-1-enyl]-1,1-dimethyl-3-(3-phenylprop-2-enyl)benzo[e]indol-3-ium |
| SMILES | COc1ccc2c(c1)C(C)(C)C(=CC=CC1=[N+](CC=Cc3ccccc3)c3ccc4ccccc4c3C1(C)C)N2CC=Cc1ccccc1 |
| InChI | InChI=1S/C46H45N2O/c1-45(2)39-33-37(49-5)28-30-40(39)47(31-15-21-34-17-8-6-9-18-34)42(45)25-14-26-43-46(3,4)44-38-24-13-12-23-36(38)27-29-41(44)48(43)32-16-22-35-19-10-7-11-20-35/h6-30,33H,31-32H2,1-5H3/q+1 |
| InChIKey | OGGCEZLYXDTLLD-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.88 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|