About prop-2-enoyloxycarbonyl prop-2-enoate
prop-2-enoyloxycarbonyl prop-2-enoate (PubChem CID 54148783) has the molecular formula C7H6O5
and a molecular weight of 170.12 g/mol. Its IUPAC name is prop-2-enoyloxycarbonyl prop-2-enoate.
Molecular Properties
| Compound Name | prop-2-enoyloxycarbonyl prop-2-enoate |
| PubChem CID | 54148783 |
| Molecular Formula | C7H6O5 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | prop-2-enoyloxycarbonyl prop-2-enoate |
| SMILES | C=CC(=O)OC(=O)OC(=O)C=C |
| InChI | InChI=1S/C7H6O5/c1-3-5(8)11-7(10)12-6(9)4-2/h3-4H,1-2H2 |
| InChIKey | OGGMARVIJLWYIU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoyloxycarbonyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoyloxycarbonyl prop-2-enoate?
The IUPAC name of prop-2-enoyloxycarbonyl prop-2-enoate (CID 54148783) is prop-2-enoyloxycarbonyl prop-2-enoate.
What is the SMILES notation for prop-2-enoyloxycarbonyl prop-2-enoate?
The canonical SMILES for prop-2-enoyloxycarbonyl prop-2-enoate is C=CC(=O)OC(=O)OC(=O)C=C.
What is the InChIKey of prop-2-enoyloxycarbonyl prop-2-enoate?
The InChIKey is OGGMARVIJLWYIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5/c1-3-5(8)11-7(10)12-6(9)4-2/h3-4H,1-2H2.
What are the key properties of prop-2-enoyloxycarbonyl prop-2-enoate?
prop-2-enoyloxycarbonyl prop-2-enoate has a molecular weight of 170.12 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoyloxycarbonyl prop-2-enoate is sourced from PubChem (CID 54148783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).