About 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol
1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol (PubChem CID 54149035) has the molecular formula C12H19NO3S
and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol |
| PubChem CID | 54149035 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)(CN)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19NO3S/c1-11(2,3)12(14,9-13)17(15,16)10-7-5-4-6-8-10/h4-8,14H,9,13H2,1-3H3 |
| InChIKey | OGKZJNLCEPYMCK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol?
The IUPAC name of 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol (CID 54149035) is 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol.
What is the SMILES notation for 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol?
The canonical SMILES for 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol is CC(C)(C)C(O)(CN)S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol?
The InChIKey is OGKZJNLCEPYMCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3S/c1-11(2,3)12(14,9-13)17(15,16)10-7-5-4-6-8-10/h4-8,14H,9,13H2,1-3H3.
What are the key properties of 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol?
1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol has a molecular weight of 257.36 g/mol, XLogP of 1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol is sourced from PubChem (CID 54149035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).