C12H19NO3S — CID 54149035
1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol (PubChem CID 54149035) has the molecular formula C12H19NO3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol.
| Compound Name | 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 54149035 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-amino-2-(benzenesulfonyl)-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)(CN)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19NO3S/c1-11(2,3)12(14,9-13)17(15,16)10-7-5-4-6-8-10/h4-8,14H,9,13H2,1-3H3 |
| InChIKey | OGKZJNLCEPYMCK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |