C20H21N3O14S2 — CID 54149502
3-(2,5-dihydroxypyrrol-1-yl)-1-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy-2,5-dioxopyrrolidine-3,4-disulfonic acid (PubChem CID 54149502) has the molecular formula C20H21N3O14S2 and a molecular weight of 591.53 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)-1-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy-2,5-dioxopyrrolidine-3,4-disulfonic acid.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)-1-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy-2,5-dioxopyrrolidine-3,4-disulfonic acid |
|---|---|
| PubChem CID | 54149502 |
| Molecular Formula | C20H21N3O14S2 |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 591.05 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)-1-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy-2,5-dioxopyrrolidine-3,4-disulfonic acid |
| SMILES | O=C(ON1C(=O)C(S(=O)(=O)O)C(n2c(O)ccc2O)(S(=O)(=O)O)C1=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C20H21N3O14S2/c24-12-5-6-13(25)21(12)9-10-1-3-11(4-2-10)18(29)37-23-17(28)16(38(31,32)33)20(19(23)30,39(34,35)36)22-14(26)7-8-15(22)27/h5-8,10-11,16,26-27H,1-4,9H2,(H,31,32,33)(H,34,35,36) |
| InChIKey | OGTJDKFYPSTYAZ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 255.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|