C16H24N2O5 — CID 54149602
[(1S,2R,4S,6S,10S)-7-(diethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate (PubChem CID 54149602) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is [(1S,2R,4S,6S,10S)-7-(diethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate.
| Compound Name | [(1S,2R,4S,6S,10S)-7-(diethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 54149602 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [(1S,2R,4S,6S,10S)-7-(diethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
| SMILES | CCN(CC)C(=O)C1=CO[C@@H](OC(=O)NC)[C@H]2[C@@H]1C[C@@H]1O[C@]21C |
| InChI | InChI=1S/C16H24N2O5/c1-5-18(6-2)13(19)10-8-21-14(22-15(20)17-4)12-9(10)7-11-16(12,3)23-11/h8-9,11-12,14H,5-7H2,1-4H3,(H,17,20)/t9-,11+,12-,14+,16+/m1/s1 |
| InChIKey | OGVCHNCWFWIVSF-AKAGURMFSA-N |
| XLogP | 1.24 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|