C12H15NO2 — CID 54149800
N,4-bis(oxiran-2-ylmethyl)aniline (PubChem CID 54149800) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N,4-bis(oxiran-2-ylmethyl)aniline.
| Compound Name | N,4-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 54149800 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N,4-bis(oxiran-2-ylmethyl)aniline |
| SMILES | c1cc(NCC2CO2)ccc1CC1CO1 |
| InChI | InChI=1S/C12H15NO2/c1-3-10(13-6-12-8-15-12)4-2-9(1)5-11-7-14-11/h1-4,11-13H,5-8H2 |
| InChIKey | GPZUZWAMFSNLDP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 37.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|