C36H39NO5 — CID 54150229
(3aS,4S,5R,6R,7S,7aS)-1-methyl-4,5,6,7-tetrakis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole (PubChem CID 54150229) has the molecular formula C36H39NO5 and a molecular weight of 565.71 g/mol. Its IUPAC name is (3aS,4S,5R,6R,7S,7aS)-1-methyl-4,5,6,7-tetrakis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole.
| Compound Name | (3aS,4S,5R,6R,7S,7aS)-1-methyl-4,5,6,7-tetrakis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
|---|---|
| PubChem CID | 54150229 |
| Molecular Formula | C36H39NO5 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | (3aS,4S,5R,6R,7S,7aS)-1-methyl-4,5,6,7-tetrakis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
| SMILES | CN1OC[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]21 |
| InChI | InChI=1S/C36H39NO5/c1-37-32-31(26-42-37)33(38-22-27-14-6-2-7-15-27)35(40-24-29-18-10-4-11-19-29)36(41-25-30-20-12-5-13-21-30)34(32)39-23-28-16-8-3-9-17-28/h2-21,31-36H,22-26H2,1H3/t31-,32+,33+,34+,35-,36-/m1/s1 |
| InChIKey | OHFGWBPRTOGCCG-WSWOWXIISA-N |
| XLogP | 6.20 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |