C12H24NO5P — CID 54150892
2-[(5-methyl-1-phosphono-2-propan-2-ylcyclohexyl)amino]acetic acid (PubChem CID 54150892) has the molecular formula C12H24NO5P and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[(5-methyl-1-phosphono-2-propan-2-ylcyclohexyl)amino]acetic acid.
| Compound Name | 2-[(5-methyl-1-phosphono-2-propan-2-ylcyclohexyl)amino]acetic acid |
|---|---|
| PubChem CID | 54150892 |
| Molecular Formula | C12H24NO5P |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[(5-methyl-1-phosphono-2-propan-2-ylcyclohexyl)amino]acetic acid |
| SMILES | CC1CCC(C(C)C)C(NCC(=O)O)(P(=O)(O)O)C1 |
| InChI | InChI=1S/C12H24NO5P/c1-8(2)10-5-4-9(3)6-12(10,19(16,17)18)13-7-11(14)15/h8-10,13H,4-7H2,1-3H3,(H,14,15)(H2,16,17,18) |
| InChIKey | OHQUHIQUXPIEBK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|