About 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one
2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one (PubChem CID 54150985) has the molecular formula C8H11N5O3
and a molecular weight of 225.21 g/mol. Its IUPAC name is 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one.
Molecular Properties
| Compound Name | 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one |
| PubChem CID | 54150985 |
| Molecular Formula | C8H11N5O3 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one |
| SMILES | NC1(CO)NC(=O)c2nccnc2N1CO |
| InChI | InChI=1S/C8H11N5O3/c9-8(3-14)12-7(16)5-6(13(8)4-15)11-2-1-10-5/h1-2,14-15H,3-4,9H2,(H,12,16) |
| InChIKey | OHSJWMYJQJZWIG-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one?
The IUPAC name of 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one (CID 54150985) is 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one.
What is the SMILES notation for 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one?
The canonical SMILES for 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one is NC1(CO)NC(=O)c2nccnc2N1CO.
What is the InChIKey of 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one?
The InChIKey is OHSJWMYJQJZWIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O3/c9-8(3-14)12-7(16)5-6(13(8)4-15)11-2-1-10-5/h1-2,14-15H,3-4,9H2,(H,12,16).
What are the key properties of 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one?
2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one has a molecular weight of 225.21 g/mol, XLogP of -2.42, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,2-bis(hydroxymethyl)-3H-pteridin-4-one is sourced from PubChem (CID 54150985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).