About 1H-pyrrole-2,3,4-tricarboxamide
1H-pyrrole-2,3,4-tricarboxamide (PubChem CID 54151063) has the molecular formula C7H8N4O3
and a molecular weight of 196.17 g/mol. Its IUPAC name is 1H-pyrrole-2,3,4-tricarboxamide.
Molecular Properties
| Compound Name | 1H-pyrrole-2,3,4-tricarboxamide |
| PubChem CID | 54151063 |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 1H-pyrrole-2,3,4-tricarboxamide |
| SMILES | NC(=O)c1c[nH]c(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C7H8N4O3/c8-5(12)2-1-11-4(7(10)14)3(2)6(9)13/h1,11H,(H2,8,12)(H2,9,13)(H2,10,14) |
| InChIKey | OHTVJLOSESMKCF-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 145.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrrole-2,3,4-tricarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-2,3,4-tricarboxamide?
The IUPAC name of 1H-pyrrole-2,3,4-tricarboxamide (CID 54151063) is 1H-pyrrole-2,3,4-tricarboxamide.
What is the SMILES notation for 1H-pyrrole-2,3,4-tricarboxamide?
The canonical SMILES for 1H-pyrrole-2,3,4-tricarboxamide is NC(=O)c1c[nH]c(C(N)=O)c1C(N)=O.
What is the InChIKey of 1H-pyrrole-2,3,4-tricarboxamide?
The InChIKey is OHTVJLOSESMKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O3/c8-5(12)2-1-11-4(7(10)14)3(2)6(9)13/h1,11H,(H2,8,12)(H2,9,13)(H2,10,14).
What are the key properties of 1H-pyrrole-2,3,4-tricarboxamide?
1H-pyrrole-2,3,4-tricarboxamide has a molecular weight of 196.17 g/mol, XLogP of -1.69, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-2,3,4-tricarboxamide is sourced from PubChem (CID 54151063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).