About 3-chloro-2,5-dioxooxolane-3-carbaldehyde
3-chloro-2,5-dioxooxolane-3-carbaldehyde (PubChem CID 54151069) has the molecular formula C5H3ClO4
and a molecular weight of 162.53 g/mol. Its IUPAC name is 3-chloro-2,5-dioxooxolane-3-carbaldehyde.
Molecular Properties
| Compound Name | 3-chloro-2,5-dioxooxolane-3-carbaldehyde |
| PubChem CID | 54151069 |
| Molecular Formula | C5H3ClO4 |
| Molecular Weight | 162.53 g/mol |
| Exact Mass | 161.97 |
| IUPAC Name | 3-chloro-2,5-dioxooxolane-3-carbaldehyde |
| SMILES | O=CC1(Cl)CC(=O)OC1=O |
| InChI | InChI=1S/C5H3ClO4/c6-5(2-7)1-3(8)10-4(5)9/h2H,1H2 |
| InChIKey | OHTYSEJBCVYNPS-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.53 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,5-dioxooxolane-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,5-dioxooxolane-3-carbaldehyde?
The IUPAC name of 3-chloro-2,5-dioxooxolane-3-carbaldehyde (CID 54151069) is 3-chloro-2,5-dioxooxolane-3-carbaldehyde.
What is the SMILES notation for 3-chloro-2,5-dioxooxolane-3-carbaldehyde?
The canonical SMILES for 3-chloro-2,5-dioxooxolane-3-carbaldehyde is O=CC1(Cl)CC(=O)OC1=O.
What is the InChIKey of 3-chloro-2,5-dioxooxolane-3-carbaldehyde?
The InChIKey is OHTYSEJBCVYNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClO4/c6-5(2-7)1-3(8)10-4(5)9/h2H,1H2.
What are the key properties of 3-chloro-2,5-dioxooxolane-3-carbaldehyde?
3-chloro-2,5-dioxooxolane-3-carbaldehyde has a molecular weight of 162.53 g/mol, XLogP of -0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,5-dioxooxolane-3-carbaldehyde is sourced from PubChem (CID 54151069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).