6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid

C12H12N2O3 — CID 54151724

IUPAC6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid
SMILESCCOc1cc2cc(C(=O)O)cnc2nc1C
InChIInChI=1S/C12H12N2O3/c1-3-17-10-5-8-4-9(12(15)16)6-13-11(8)14-7(10)2/h4-6H,3H2,1-2H3,(H,15,16)
InChIKeyOIFDMJDJYHFNSH-UHFFFAOYSA-N
MW232.24 g/mol
LogP2.04
Rot. Bonds3

About 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid

6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid (PubChem CID 54151724) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid
PubChem CID54151724
Molecular FormulaC12H12N2O3
Molecular Weight232.24 g/mol
Exact Mass232.08
IUPAC Name6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid
SMILESCCOc1cc2cc(C(=O)O)cnc2nc1C
InChIInChI=1S/C12H12N2O3/c1-3-17-10-5-8-4-9(12(15)16)6-13-11(8)14-7(10)2/h4-6H,3H2,1-2H3,(H,15,16)
InChIKeyOIFDMJDJYHFNSH-UHFFFAOYSA-N
XLogP2.04
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 52.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid?
The IUPAC name of 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid (CID 54151724) is 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid?
The canonical SMILES for 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid is CCOc1cc2cc(C(=O)O)cnc2nc1C.
What is the InChIKey of 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid?
The InChIKey is OIFDMJDJYHFNSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-3-17-10-5-8-4-9(12(15)16)6-13-11(8)14-7(10)2/h4-6H,3H2,1-2H3,(H,15,16).
What are the key properties of 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid?
6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid has a molecular weight of 232.24 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-7-methyl-1,8-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 54151724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).