About 1-(dimethylamino)-1,3,3-trimethylurea
1-(dimethylamino)-1,3,3-trimethylurea (PubChem CID 54151962) has the molecular formula C6H15N3O
and a molecular weight of 145.21 g/mol. Its IUPAC name is 1-(dimethylamino)-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-(dimethylamino)-1,3,3-trimethylurea |
| PubChem CID | 54151962 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 1-(dimethylamino)-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)N(C)C |
| InChI | InChI=1S/C6H15N3O/c1-7(2)6(10)9(5)8(3)4/h1-5H3 |
| InChIKey | OIJJVZNKPLVDPB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)-1,3,3-trimethylurea?
The IUPAC name of 1-(dimethylamino)-1,3,3-trimethylurea (CID 54151962) is 1-(dimethylamino)-1,3,3-trimethylurea.
What is the SMILES notation for 1-(dimethylamino)-1,3,3-trimethylurea?
The canonical SMILES for 1-(dimethylamino)-1,3,3-trimethylurea is CN(C)C(=O)N(C)N(C)C.
What is the InChIKey of 1-(dimethylamino)-1,3,3-trimethylurea?
The InChIKey is OIJJVZNKPLVDPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O/c1-7(2)6(10)9(5)8(3)4/h1-5H3.
What are the key properties of 1-(dimethylamino)-1,3,3-trimethylurea?
1-(dimethylamino)-1,3,3-trimethylurea has a molecular weight of 145.21 g/mol, XLogP of 0.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)-1,3,3-trimethylurea is sourced from PubChem (CID 54151962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).