6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid

C10H15NO5 — CID 54152138

IUPAC6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid
SMILESO=C(CCCCCn1c(O)ccc1O)OO
InChIInChI=1S/C10H15NO5/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)16-15/h5-6,12-13,15H,1-4,7H2
InChIKeyOIMDDDFXPTYWSK-UHFFFAOYSA-N
MW229.23 g/mol
LogP1.48
Rot. Bonds6

About 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid

6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid (PubChem CID 54152138) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid.

Molecular Properties

Compound Name6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid
PubChem CID54152138
Molecular FormulaC10H15NO5
Molecular Weight229.23 g/mol
Exact Mass229.10
IUPAC Name6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid
SMILESO=C(CCCCCn1c(O)ccc1O)OO
InChIInChI=1S/C10H15NO5/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)16-15/h5-6,12-13,15H,1-4,7H2
InChIKeyOIMDDDFXPTYWSK-UHFFFAOYSA-N
XLogP1.48
TPSA91.92 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.23
LogP ≤ 51.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid?
The IUPAC name of 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid (CID 54152138) is 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid.
What is the SMILES notation for 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid?
The canonical SMILES for 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid is O=C(CCCCCn1c(O)ccc1O)OO.
What is the InChIKey of 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid?
The InChIKey is OIMDDDFXPTYWSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO5/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)16-15/h5-6,12-13,15H,1-4,7H2.
What are the key properties of 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid?
6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid has a molecular weight of 229.23 g/mol, XLogP of 1.48, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dihydroxypyrrol-1-yl)hexaneperoxoic acid is sourced from PubChem (CID 54152138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).