C23H42O4 — CID 54152139
methyl 7-[(1R,2R)-2-hydroxy-5-(3-hydroxy-4,4-dimethyloctylidene)cyclopentyl]heptanoate (PubChem CID 54152139) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-hydroxy-5-(3-hydroxy-4,4-dimethyloctylidene)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R)-2-hydroxy-5-(3-hydroxy-4,4-dimethyloctylidene)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 54152139 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | methyl 7-[(1R,2R)-2-hydroxy-5-(3-hydroxy-4,4-dimethyloctylidene)cyclopentyl]heptanoate |
| SMILES | CCCCC(C)(C)C(O)CC=C1CC[C@@H](O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H42O4/c1-5-6-17-23(2,3)21(25)16-14-18-13-15-20(24)19(18)11-9-7-8-10-12-22(26)27-4/h14,19-21,24-25H,5-13,15-17H2,1-4H3/t19-,20-,21?/m1/s1 |
| InChIKey | OIMDMSFUHJROLE-OSBQEZSISA-N |
| XLogP | 5.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|