About 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane
2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane (PubChem CID 54152877) has the molecular formula C13H16F3NO
and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane.
Molecular Properties
| Compound Name | 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane |
| PubChem CID | 54152877 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane |
| SMILES | CC.CC#CC(O)(c1ccccc1N)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO.C2H6/c1-2-7-10(16,11(12,13)14)8-5-3-4-6-9(8)15;1-2/h3-6,16H,15H2,1H3;1-2H3 |
| InChIKey | OIYQDTZEOPLHKK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane?
The IUPAC name of 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane (CID 54152877) is 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane.
What is the SMILES notation for 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane?
The canonical SMILES for 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane is CC.CC#CC(O)(c1ccccc1N)C(F)(F)F.
What is the InChIKey of 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane?
The InChIKey is OIYQDTZEOPLHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO.C2H6/c1-2-7-10(16,11(12,13)14)8-5-3-4-6-9(8)15;1-2/h3-6,16H,15H2,1H3;1-2H3.
What are the key properties of 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane?
2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane has a molecular weight of 259.27 g/mol, XLogP of 3.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol;ethane is sourced from PubChem (CID 54152877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).