C25H56O4Si2 — CID 54152943
[11-[dimethoxy(methyl)silyl]-2,2,4,4,6,6,8,8-octamethylundecyl]-dimethoxy-methylsilane (PubChem CID 54152943) has the molecular formula C25H56O4Si2 and a molecular weight of 476.89 g/mol. Its IUPAC name is [11-[dimethoxy(methyl)silyl]-2,2,4,4,6,6,8,8-octamethylundecyl]-dimethoxy-methylsilane.
| Compound Name | [11-[dimethoxy(methyl)silyl]-2,2,4,4,6,6,8,8-octamethylundecyl]-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 54152943 |
| Molecular Formula | C25H56O4Si2 |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | [11-[dimethoxy(methyl)silyl]-2,2,4,4,6,6,8,8-octamethylundecyl]-dimethoxy-methylsilane |
| SMILES | CO[Si](C)(CCCC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)C[Si](C)(OC)OC)OC |
| InChI | InChI=1S/C25H56O4Si2/c1-22(2,16-15-17-30(13,26-9)27-10)18-23(3,4)19-24(5,6)20-25(7,8)21-31(14,28-11)29-12/h15-21H2,1-14H3 |
| InChIKey | OIZWTERDTNLIHA-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|