About 1-(3-bromo-N,4-dimethylanilino)propan-2-ol
1-(3-bromo-N,4-dimethylanilino)propan-2-ol (PubChem CID 54152954) has the molecular formula C11H16BrNO
and a molecular weight of 258.16 g/mol. Its IUPAC name is 1-(3-bromo-N,4-dimethylanilino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(3-bromo-N,4-dimethylanilino)propan-2-ol |
| PubChem CID | 54152954 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-(3-bromo-N,4-dimethylanilino)propan-2-ol |
| SMILES | Cc1ccc(N(C)CC(C)O)cc1Br |
| InChI | InChI=1S/C11H16BrNO/c1-8-4-5-10(6-11(8)12)13(3)7-9(2)14/h4-6,9,14H,7H2,1-3H3 |
| InChIKey | OIZZPLIBUFLZOZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-bromo-N,4-dimethylanilino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromo-N,4-dimethylanilino)propan-2-ol?
The IUPAC name of 1-(3-bromo-N,4-dimethylanilino)propan-2-ol (CID 54152954) is 1-(3-bromo-N,4-dimethylanilino)propan-2-ol.
What is the SMILES notation for 1-(3-bromo-N,4-dimethylanilino)propan-2-ol?
The canonical SMILES for 1-(3-bromo-N,4-dimethylanilino)propan-2-ol is Cc1ccc(N(C)CC(C)O)cc1Br.
What is the InChIKey of 1-(3-bromo-N,4-dimethylanilino)propan-2-ol?
The InChIKey is OIZZPLIBUFLZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrNO/c1-8-4-5-10(6-11(8)12)13(3)7-9(2)14/h4-6,9,14H,7H2,1-3H3.
What are the key properties of 1-(3-bromo-N,4-dimethylanilino)propan-2-ol?
1-(3-bromo-N,4-dimethylanilino)propan-2-ol has a molecular weight of 258.16 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromo-N,4-dimethylanilino)propan-2-ol is sourced from PubChem (CID 54152954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).