C34H48O2 — CID 54152968
[(1S)-3-[2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] benzoate (PubChem CID 54152968) has the molecular formula C34H48O2 and a molecular weight of 488.76 g/mol. Its IUPAC name is [(1S)-3-[2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] benzoate.
| Compound Name | [(1S)-3-[2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] benzoate |
|---|---|
| PubChem CID | 54152968 |
| Molecular Formula | C34H48O2 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | [(1S)-3-[2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] benzoate |
| SMILES | C=C1CC[C@H](OC(=O)c2ccccc2)CC1=CC=C1CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C34H48O2/c1-24(2)11-9-12-26(4)31-20-21-32-27(15-10-22-34(31,32)5)17-18-29-23-30(19-16-25(29)3)36-33(35)28-13-7-6-8-14-28/h6-8,13-14,17-18,24,26,30-32H,3,9-12,15-16,19-23H2,1-2,4-5H3/t26-,30+,31-,32?,34-/m1/s1 |
| InChIKey | OJAIJGMTKQWGTO-GZBURXDWSA-N |
| XLogP | 9.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |