About 4,4-dimethoxybut-2-enal
4,4-dimethoxybut-2-enal (PubChem CID 54153231) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is 4,4-dimethoxybut-2-enal.
Molecular Properties
| Compound Name | 4,4-dimethoxybut-2-enal |
| PubChem CID | 54153231 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 4,4-dimethoxybut-2-enal |
| SMILES | COC(C=CC=O)OC |
| InChI | InChI=1S/C6H10O3/c1-8-6(9-2)4-3-5-7/h3-6H,1-2H3 |
| InChIKey | OJFHAFJGQZSFKT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethoxybut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethoxybut-2-enal?
The IUPAC name of 4,4-dimethoxybut-2-enal (CID 54153231) is 4,4-dimethoxybut-2-enal.
What is the SMILES notation for 4,4-dimethoxybut-2-enal?
The canonical SMILES for 4,4-dimethoxybut-2-enal is COC(C=CC=O)OC.
What is the InChIKey of 4,4-dimethoxybut-2-enal?
The InChIKey is OJFHAFJGQZSFKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-8-6(9-2)4-3-5-7/h3-6H,1-2H3.
What are the key properties of 4,4-dimethoxybut-2-enal?
4,4-dimethoxybut-2-enal has a molecular weight of 130.14 g/mol, XLogP of 0.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethoxybut-2-enal is sourced from PubChem (CID 54153231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).