About ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate
ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate (PubChem CID 54153386) has the molecular formula C12H10Cl2O3
and a molecular weight of 273.12 g/mol. Its IUPAC name is ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate |
| PubChem CID | 54153386 |
| Molecular Formula | C12H10Cl2O3 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate |
| SMILES | CCOC(=O)C=CC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl2O3/c1-2-17-12(16)6-5-11(15)9-4-3-8(13)7-10(9)14/h3-7H,2H2,1H3 |
| InChIKey | OJIGOFYKQNIICL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate?
The IUPAC name of ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate (CID 54153386) is ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate.
What is the SMILES notation for ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate?
The canonical SMILES for ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate is CCOC(=O)C=CC(=O)c1ccc(Cl)cc1Cl.
What is the InChIKey of ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate?
The InChIKey is OJIGOFYKQNIICL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2O3/c1-2-17-12(16)6-5-11(15)9-4-3-8(13)7-10(9)14/h3-7H,2H2,1H3.
What are the key properties of ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate?
ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate has a molecular weight of 273.12 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,4-dichlorophenyl)-4-oxobut-2-enoate is sourced from PubChem (CID 54153386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).