C21H33F2IO4 — CID 54153477
methyl 5-[(3S,3aR,4R,6aS)-3-fluoro-4-[(4R)-4-fluorooct-1-enyl]-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate (PubChem CID 54153477) has the molecular formula C21H33F2IO4 and a molecular weight of 514.39 g/mol. Its IUPAC name is methyl 5-[(3S,3aR,4R,6aS)-3-fluoro-4-[(4R)-4-fluorooct-1-enyl]-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate.
| Compound Name | methyl 5-[(3S,3aR,4R,6aS)-3-fluoro-4-[(4R)-4-fluorooct-1-enyl]-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
|---|---|
| PubChem CID | 54153477 |
| Molecular Formula | C21H33F2IO4 |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | methyl 5-[(3S,3aR,4R,6aS)-3-fluoro-4-[(4R)-4-fluorooct-1-enyl]-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
| SMILES | CCCC[C@@H](F)CC=C[C@H]1CC(O)[C@H]2OC(C(I)CCCC(=O)OC)[C@@H](F)[C@@H]21 |
| InChI | InChI=1S/C21H33F2IO4/c1-3-4-8-14(22)9-5-7-13-12-16(25)21-18(13)19(23)20(28-21)15(24)10-6-11-17(26)27-2/h5,7,13-16,18-21,25H,3-4,6,8-12H2,1-2H3/t13-,14+,15?,16?,18-,19-,20?,21+/m0/s1 |
| InChIKey | OJJMQEUKBHPUEC-PLEJWPADSA-N |
| XLogP | 4.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|