About 2-bromo-1-nitropropane
2-bromo-1-nitropropane (PubChem CID 54153986) has the molecular formula C3H6BrNO2
and a molecular weight of 167.99 g/mol. Its IUPAC name is 2-bromo-1-nitropropane.
Molecular Properties
| Compound Name | 2-bromo-1-nitropropane |
| PubChem CID | 54153986 |
| Molecular Formula | C3H6BrNO2 |
| Molecular Weight | 167.99 g/mol |
| Exact Mass | 166.96 |
| IUPAC Name | 2-bromo-1-nitropropane |
| SMILES | CC(Br)C[N+](=O)[O-] |
| InChI | InChI=1S/C3H6BrNO2/c1-3(4)2-5(6)7/h3H,2H2,1H3 |
| InChIKey | OJTCHRVTNNKYDO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.99 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-nitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-nitropropane?
The IUPAC name of 2-bromo-1-nitropropane (CID 54153986) is 2-bromo-1-nitropropane.
What is the SMILES notation for 2-bromo-1-nitropropane?
The canonical SMILES for 2-bromo-1-nitropropane is CC(Br)C[N+](=O)[O-].
What is the InChIKey of 2-bromo-1-nitropropane?
The InChIKey is OJTCHRVTNNKYDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BrNO2/c1-3(4)2-5(6)7/h3H,2H2,1H3.
What are the key properties of 2-bromo-1-nitropropane?
2-bromo-1-nitropropane has a molecular weight of 167.99 g/mol, XLogP of 1.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-nitropropane is sourced from PubChem (CID 54153986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).