C11H10N6O4S2 — CID 54154075
2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-3-propyl-5,6-dihydroimidazo[4,5-d]pyridazine-4,7-dione (PubChem CID 54154075) has the molecular formula C11H10N6O4S2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-3-propyl-5,6-dihydroimidazo[4,5-d]pyridazine-4,7-dione.
| Compound Name | 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-3-propyl-5,6-dihydroimidazo[4,5-d]pyridazine-4,7-dione |
|---|---|
| PubChem CID | 54154075 |
| Molecular Formula | C11H10N6O4S2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-3-propyl-5,6-dihydroimidazo[4,5-d]pyridazine-4,7-dione |
| SMILES | CCCn1c(Sc2ncc([N+](=O)[O-])s2)nc2c(=O)[nH][nH]c(=O)c21 |
| InChI | InChI=1S/C11H10N6O4S2/c1-2-3-16-7-6(8(18)14-15-9(7)19)13-10(16)23-11-12-4-5(22-11)17(20)21/h4H,2-3H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | OJUOZQXNSUGHKZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|