About ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate
ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate (PubChem CID 54154131) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate |
| PubChem CID | 54154131 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate |
| SMILES | CCOC(=O)CCOCCC1=NCCN1 |
| InChI | InChI=1S/C10H18N2O3/c1-2-15-10(13)4-8-14-7-3-9-11-5-6-12-9/h2-8H2,1H3,(H,11,12) |
| InChIKey | OJVKUHAWFWRCDO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate?
The IUPAC name of ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate (CID 54154131) is ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate.
What is the SMILES notation for ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate?
The canonical SMILES for ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate is CCOC(=O)CCOCCC1=NCCN1.
What is the InChIKey of ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate?
The InChIKey is OJVKUHAWFWRCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-2-15-10(13)4-8-14-7-3-9-11-5-6-12-9/h2-8H2,1H3,(H,11,12).
What are the key properties of ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate?
ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate has a molecular weight of 214.26 g/mol, XLogP of 0.35, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-(4,5-dihydro-1H-imidazol-2-yl)ethoxy]propanoate is sourced from PubChem (CID 54154131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).