About 1-butyl-1-oxo-1λ5-phospholane-3,4-diol
1-butyl-1-oxo-1λ5-phospholane-3,4-diol (PubChem CID 54154627) has the molecular formula C8H17O3P
and a molecular weight of 192.19 g/mol. Its IUPAC name is 1-butyl-1-oxo-1λ5-phospholane-3,4-diol.
Molecular Properties
| Compound Name | 1-butyl-1-oxo-1λ5-phospholane-3,4-diol |
| PubChem CID | 54154627 |
| Molecular Formula | C8H17O3P |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-butyl-1-oxo-1λ5-phospholane-3,4-diol |
| SMILES | CCCCP1(=O)CC(O)C(O)C1 |
| InChI | InChI=1S/C8H17O3P/c1-2-3-4-12(11)5-7(9)8(10)6-12/h7-10H,2-6H2,1H3 |
| InChIKey | OKEBGVHVPDDHOT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1-oxo-1λ5-phospholane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1-oxo-1λ5-phospholane-3,4-diol?
The IUPAC name of 1-butyl-1-oxo-1λ5-phospholane-3,4-diol (CID 54154627) is 1-butyl-1-oxo-1λ5-phospholane-3,4-diol.
What is the SMILES notation for 1-butyl-1-oxo-1λ5-phospholane-3,4-diol?
The canonical SMILES for 1-butyl-1-oxo-1λ5-phospholane-3,4-diol is CCCCP1(=O)CC(O)C(O)C1.
What is the InChIKey of 1-butyl-1-oxo-1λ5-phospholane-3,4-diol?
The InChIKey is OKEBGVHVPDDHOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O3P/c1-2-3-4-12(11)5-7(9)8(10)6-12/h7-10H,2-6H2,1H3.
What are the key properties of 1-butyl-1-oxo-1λ5-phospholane-3,4-diol?
1-butyl-1-oxo-1λ5-phospholane-3,4-diol has a molecular weight of 192.19 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1-oxo-1λ5-phospholane-3,4-diol is sourced from PubChem (CID 54154627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).