About 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one
4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one (PubChem CID 541549) has the molecular formula C10H11N3O5
and a molecular weight of 253.21 g/mol. Its IUPAC name is 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one |
| PubChem CID | 541549 |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one |
| SMILES | O=C1NOCC1NCc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C10H11N3O5/c14-9-2-1-7(13(16)17)3-6(9)4-11-8-5-18-12-10(8)15/h1-3,8,11,14H,4-5H2,(H,12,15) |
| InChIKey | LFFVUGRMAAADDX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one?
The IUPAC name of 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one (CID 541549) is 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one.
What is the SMILES notation for 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one?
The canonical SMILES for 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one is O=C1NOCC1NCc1cc([N+](=O)[O-])ccc1O.
What is the InChIKey of 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one?
The InChIKey is LFFVUGRMAAADDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O5/c14-9-2-1-7(13(16)17)3-6(9)4-11-8-5-18-12-10(8)15/h1-3,8,11,14H,4-5H2,(H,12,15).
What are the key properties of 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one?
4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one has a molecular weight of 253.21 g/mol, XLogP of -0.18, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-hydroxy-5-nitrophenyl)methylamino]-1,2-oxazolidin-3-one is sourced from PubChem (CID 541549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).