About [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate (PubChem CID 54155044) has the molecular formula C18H18F6O3S
and a molecular weight of 428.39 g/mol. Its IUPAC name is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate.
Molecular Properties
| Compound Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate |
| PubChem CID | 54155044 |
| Molecular Formula | C18H18F6O3S |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H18F6O3S/c1-2-3-4-11-26-14-7-5-13(6-8-14)18(25)27-15-9-10-17(16(19)12-15)28(20,21,22,23)24/h5-10,12H,2-4,11H2,1H3 |
| InChIKey | OKLIHHKQBVYBHB-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate?
The IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate (CID 54155044) is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate.
What is the SMILES notation for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate?
The canonical SMILES for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate is CCCCCOc1ccc(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)cc1.
What is the InChIKey of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate?
The InChIKey is OKLIHHKQBVYBHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F6O3S/c1-2-3-4-11-26-14-7-5-13(6-8-14)18(25)27-15-9-10-17(16(19)12-15)28(20,21,22,23)24/h5-10,12H,2-4,11H2,1H3.
What are the key properties of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate?
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate has a molecular weight of 428.39 g/mol, XLogP of 7.27, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentoxybenzoate is sourced from PubChem (CID 54155044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).