C44H43N6O4+ — CID 54155462
methyl 4-[3,4-bis[2-(1H-indol-3-yl)ethyl]-1-(6-methoxycarbonyl-1H-indol-4-yl)piperazin-1-ium-1-yl]-1H-indole-6-carboxylate (PubChem CID 54155462) has the molecular formula C44H43N6O4+ and a molecular weight of 719.87 g/mol. Its IUPAC name is methyl 4-[3,4-bis[2-(1H-indol-3-yl)ethyl]-1-(6-methoxycarbonyl-1H-indol-4-yl)piperazin-1-ium-1-yl]-1H-indole-6-carboxylate.
| Compound Name | methyl 4-[3,4-bis[2-(1H-indol-3-yl)ethyl]-1-(6-methoxycarbonyl-1H-indol-4-yl)piperazin-1-ium-1-yl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 54155462 |
| Molecular Formula | C44H43N6O4+ |
| Molecular Weight | 719.87 g/mol |
| Exact Mass | 719.33 |
| IUPAC Name | methyl 4-[3,4-bis[2-(1H-indol-3-yl)ethyl]-1-(6-methoxycarbonyl-1H-indol-4-yl)piperazin-1-ium-1-yl]-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1cc([N+]2(c3cc(C(=O)OC)cc4[nH]ccc34)CCN(CCc3c[nH]c4ccccc34)C(CCc3c[nH]c4ccccc34)C2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C44H42N6O4/c1-53-43(51)30-21-39-35(13-16-45-39)41(23-30)50(42-24-31(44(52)54-2)22-40-36(42)14-17-46-40)20-19-49(18-15-29-26-48-38-10-6-4-8-34(29)38)32(27-50)12-11-28-25-47-37-9-5-3-7-33(28)37/h3-10,13-14,16-17,21-26,32,47-48H,11-12,15,18-20,27H2,1-2H3,(H-,45,46,51,52)/p+1 |
| InChIKey | DPTWHDAZNIVLNF-UHFFFAOYSA-O |
| XLogP | 8.38 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.87 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|