C19H28N2O4S2 — CID 54155721
2-[[4-methylsulfanyl-2-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]butanoyl]amino]-3-phenylpropanoic acid (PubChem CID 54155721) has the molecular formula C19H28N2O4S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 2-[[4-methylsulfanyl-2-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]butanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[4-methylsulfanyl-2-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]butanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 54155721 |
| Molecular Formula | C19H28N2O4S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[[4-methylsulfanyl-2-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]butanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CSCCC(NC(=O)[C@@H](S)C(C)C)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H28N2O4S2/c1-12(2)16(26)18(23)20-14(9-10-27-3)17(22)21-15(19(24)25)11-13-7-5-4-6-8-13/h4-8,12,14-16,26H,9-11H2,1-3H3,(H,20,23)(H,21,22)(H,24,25)/t14?,15?,16-/m0/s1 |
| InChIKey | OKWWGHVNJGRWBT-GPANFISMSA-N |
| XLogP | 1.99 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|