C25H23F2NO6 — CID 54155748
5-O-(2-benzoyloxyethyl) 3-O-methyl 4-(2,3-difluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54155748) has the molecular formula C25H23F2NO6 and a molecular weight of 471.46 g/mol. Its IUPAC name is 5-O-(2-benzoyloxyethyl) 3-O-methyl 4-(2,3-difluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2-benzoyloxyethyl) 3-O-methyl 4-(2,3-difluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54155748 |
| Molecular Formula | C25H23F2NO6 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 5-O-(2-benzoyloxyethyl) 3-O-methyl 4-(2,3-difluorophenyl)-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OCCOC(=O)c2ccccc2)C1c1cccc(F)c1F |
| InChI | InChI=1S/C25H23F2NO6/c1-14-19(24(30)32-3)21(17-10-7-11-18(26)22(17)27)20(15(2)28-14)25(31)34-13-12-33-23(29)16-8-5-4-6-9-16/h4-11,19,21H,12-13H2,1-3H3 |
| InChIKey | OKXKTGRXQYQFHO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|