About 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one
3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one (PubChem CID 54156278) has the molecular formula C16H12FN3O2S
and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one.
Molecular Properties
| Compound Name | 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one |
| PubChem CID | 54156278 |
| Molecular Formula | C16H12FN3O2S |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one |
| SMILES | CCc1oc(Nc2nccs2)c2c(=O)c3cccc(F)c3[nH]c12 |
| InChI | InChI=1S/C16H12FN3O2S/c1-2-10-13-11(15(22-10)20-16-18-6-7-23-16)14(21)8-4-3-5-9(17)12(8)19-13/h3-7,19H,2H2,1H3,(H,18,20) |
| InChIKey | WPFHWIKSSYJZDG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one?
The IUPAC name of 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one (CID 54156278) is 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one.
What is the SMILES notation for 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one?
The canonical SMILES for 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one is CCc1oc(Nc2nccs2)c2c(=O)c3cccc(F)c3[nH]c12.
What is the InChIKey of 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one?
The InChIKey is WPFHWIKSSYJZDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FN3O2S/c1-2-10-13-11(15(22-10)20-16-18-6-7-23-16)14(21)8-4-3-5-9(17)12(8)19-13/h3-7,19H,2H2,1H3,(H,18,20).
What are the key properties of 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one?
3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one has a molecular weight of 329.36 g/mol, XLogP of 4.18, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-fluoro-1-(1,3-thiazol-2-ylamino)-4H-furo[3,4-b]quinolin-9-one is sourced from PubChem (CID 54156278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).