C26H38O4 — CID 54156329
4-(3-methylbutanoyl)-2,2,6-tris(3-methylbut-2-enyl)cyclohexane-1,3,5-trione (PubChem CID 54156329) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-(3-methylbutanoyl)-2,2,6-tris(3-methylbut-2-enyl)cyclohexane-1,3,5-trione.
| Compound Name | 4-(3-methylbutanoyl)-2,2,6-tris(3-methylbut-2-enyl)cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 54156329 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 4-(3-methylbutanoyl)-2,2,6-tris(3-methylbut-2-enyl)cyclohexane-1,3,5-trione |
| SMILES | CC(C)=CCC1C(=O)C(C(=O)CC(C)C)C(=O)C(CC=C(C)C)(CC=C(C)C)C1=O |
| InChI | InChI=1S/C26H38O4/c1-16(2)9-10-20-23(28)22(21(27)15-19(7)8)25(30)26(24(20)29,13-11-17(3)4)14-12-18(5)6/h9,11-12,19-20,22H,10,13-15H2,1-8H3 |
| InChIKey | OLHLJBVALXTBSQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|