C18H30N2O — CID 54156679
ethane;(5R)-1,2,2,4,5-pentamethyl-6,7-dihydro-5H-1,4-benzodiazonin-3-one (PubChem CID 54156679) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is ethane;(5R)-1,2,2,4,5-pentamethyl-6,7-dihydro-5H-1,4-benzodiazonin-3-one.
| Compound Name | ethane;(5R)-1,2,2,4,5-pentamethyl-6,7-dihydro-5H-1,4-benzodiazonin-3-one |
|---|---|
| PubChem CID | 54156679 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | ethane;(5R)-1,2,2,4,5-pentamethyl-6,7-dihydro-5H-1,4-benzodiazonin-3-one |
| SMILES | CC.C[C@@H]1CCc2ccccc2N(C)C(C)(C)C(=O)N1C |
| InChI | InChI=1S/C16H24N2O.C2H6/c1-12-10-11-13-8-6-7-9-14(13)18(5)16(2,3)15(19)17(12)4;1-2/h6-9,12H,10-11H2,1-5H3;1-2H3/t12-;/m1./s1 |
| InChIKey | OLOPMOJBFSZZKY-UTONKHPSSA-N |
| XLogP | 3.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |