C27H43N3O6 — CID 54156724
2-[[(3S)-5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-8-(dibutylamino)octanoic acid (PubChem CID 54156724) has the molecular formula C27H43N3O6 and a molecular weight of 505.66 g/mol. Its IUPAC name is 2-[[(3S)-5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-8-(dibutylamino)octanoic acid.
| Compound Name | 2-[[(3S)-5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-8-(dibutylamino)octanoic acid |
|---|---|
| PubChem CID | 54156724 |
| Molecular Formula | C27H43N3O6 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 2-[[(3S)-5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]-8-(dibutylamino)octanoic acid |
| SMILES | CCCCN(CCCC)CCCCCCC(N[C@H]1COc2ccccc2N(CC(=O)O)C1=O)C(=O)O |
| InChI | InChI=1S/C27H43N3O6/c1-3-5-16-29(17-6-4-2)18-12-8-7-9-13-21(27(34)35)28-22-20-36-24-15-11-10-14-23(24)30(26(22)33)19-25(31)32/h10-11,14-15,21-22,28H,3-9,12-13,16-20H2,1-2H3,(H,31,32)(H,34,35)/t21?,22-/m0/s1 |
| InChIKey | OLPINLNDSGTKDD-KEKNWZKVSA-N |
| XLogP | 3.76 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|