C15H12O — CID 54156978
(1Z)-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,9,11,13,15-heptaene (PubChem CID 54156978) has the molecular formula C15H12O and a molecular weight of 208.26 g/mol. Its IUPAC name is (1Z)-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,9,11,13,15-heptaene.
| Compound Name | (1Z)-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,9,11,13,15-heptaene |
|---|---|
| PubChem CID | 54156978 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (1Z)-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,9,11,13,15-heptaene |
| SMILES | C1=COC2C=CC=C/C2=c2\ccccc2=C1 |
| InChI | InChI=1S/C15H12O/c1-2-8-13-12(6-1)7-5-11-16-15-10-4-3-9-14(13)15/h1-11,15H/b11-5?,12-7?,14-13- |
| InChIKey | OLTPJLPPIGBYEL-HAWWNEFRSA-N |
| XLogP | 1.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |