About 1-phenyloct-1-en-3-ol
1-phenyloct-1-en-3-ol (PubChem CID 54157030) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-phenyloct-1-en-3-ol.
Molecular Properties
| Compound Name | 1-phenyloct-1-en-3-ol |
| PubChem CID | 54157030 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-phenyloct-1-en-3-ol |
| SMILES | CCCCCC(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C14H20O/c1-2-3-5-10-14(15)12-11-13-8-6-4-7-9-13/h4,6-9,11-12,14-15H,2-3,5,10H2,1H3 |
| InChIKey | OLUJUQKZMDLFII-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyloct-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyloct-1-en-3-ol?
The IUPAC name of 1-phenyloct-1-en-3-ol (CID 54157030) is 1-phenyloct-1-en-3-ol.
What is the SMILES notation for 1-phenyloct-1-en-3-ol?
The canonical SMILES for 1-phenyloct-1-en-3-ol is CCCCCC(O)C=Cc1ccccc1.
What is the InChIKey of 1-phenyloct-1-en-3-ol?
The InChIKey is OLUJUQKZMDLFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O/c1-2-3-5-10-14(15)12-11-13-8-6-4-7-9-13/h4,6-9,11-12,14-15H,2-3,5,10H2,1H3.
What are the key properties of 1-phenyloct-1-en-3-ol?
1-phenyloct-1-en-3-ol has a molecular weight of 204.31 g/mol, XLogP of 3.64, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyloct-1-en-3-ol is sourced from PubChem (CID 54157030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).