About 2-methylnon-5-en-4-one
2-methylnon-5-en-4-one (PubChem CID 54157266) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 2-methylnon-5-en-4-one.
Molecular Properties
| Compound Name | 2-methylnon-5-en-4-one |
| PubChem CID | 54157266 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 2-methylnon-5-en-4-one |
| SMILES | CCCC=CC(=O)CC(C)C |
| InChI | InChI=1S/C10H18O/c1-4-5-6-7-10(11)8-9(2)3/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | OLYLRDSJTSYLER-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylnon-5-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnon-5-en-4-one?
The IUPAC name of 2-methylnon-5-en-4-one (CID 54157266) is 2-methylnon-5-en-4-one.
What is the SMILES notation for 2-methylnon-5-en-4-one?
The canonical SMILES for 2-methylnon-5-en-4-one is CCCC=CC(=O)CC(C)C.
What is the InChIKey of 2-methylnon-5-en-4-one?
The InChIKey is OLYLRDSJTSYLER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-4-5-6-7-10(11)8-9(2)3/h6-7,9H,4-5,8H2,1-3H3.
What are the key properties of 2-methylnon-5-en-4-one?
2-methylnon-5-en-4-one has a molecular weight of 154.25 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnon-5-en-4-one is sourced from PubChem (CID 54157266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).