About (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate
(2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate (PubChem CID 54157741) has the molecular formula C10H13NO6
and a molecular weight of 243.21 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate |
| PubChem CID | 54157741 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate |
| SMILES | O=C(OC1CCOCC1)On1c(O)ccc1O |
| InChI | InChI=1S/C10H13NO6/c12-8-1-2-9(13)11(8)17-10(14)16-7-3-5-15-6-4-7/h1-2,7,12-13H,3-6H2 |
| InChIKey | OMGPSBHRXURNLY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate (CID 54157741) is (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate is O=C(OC1CCOCC1)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate?
The InChIKey is OMGPSBHRXURNLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO6/c12-8-1-2-9(13)11(8)17-10(14)16-7-3-5-15-6-4-7/h1-2,7,12-13H,3-6H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate?
(2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate has a molecular weight of 243.21 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) oxan-4-yl carbonate is sourced from PubChem (CID 54157741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).