C19H38O7Si — CID 54157985
(2R,3R)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-2-yl]-3-(2-methoxyethoxymethoxy)pent-4-en-2-ol (PubChem CID 54157985) has the molecular formula C19H38O7Si and a molecular weight of 406.59 g/mol. Its IUPAC name is (2R,3R)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-2-yl]-3-(2-methoxyethoxymethoxy)pent-4-en-2-ol.
| Compound Name | (2R,3R)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-2-yl]-3-(2-methoxyethoxymethoxy)pent-4-en-2-ol |
|---|---|
| PubChem CID | 54157985 |
| Molecular Formula | C19H38O7Si |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (2R,3R)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-dioxolan-2-yl]-3-(2-methoxyethoxymethoxy)pent-4-en-2-ol |
| SMILES | C=C[C@@H](OCOCCOC)[C@H](O)CC1(CO[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C19H38O7Si/c1-8-17(23-15-22-10-9-21-5)16(20)13-19(24-11-12-25-19)14-26-27(6,7)18(2,3)4/h8,16-17,20H,1,9-15H2,2-7H3/t16-,17-/m1/s1 |
| InChIKey | OMKOSHZXWARARC-IAGOWNOFSA-N |
| XLogP | 2.69 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|