C17H29N3O4 — CID 54158221
2-[1-[(1-acetylpiperidin-4-yl)methyl]-2-oxopiperidin-3-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 54158221) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[1-[(1-acetylpiperidin-4-yl)methyl]-2-oxopiperidin-3-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[1-[(1-acetylpiperidin-4-yl)methyl]-2-oxopiperidin-3-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 54158221 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 2-[1-[(1-acetylpiperidin-4-yl)methyl]-2-oxopiperidin-3-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | CC(=O)N1CCC(CN2CCCC(CC(=O)NCCO)C2=O)CC1 |
| InChI | InChI=1S/C17H29N3O4/c1-13(22)19-8-4-14(5-9-19)12-20-7-2-3-15(17(20)24)11-16(23)18-6-10-21/h14-15,21H,2-12H2,1H3,(H,18,23) |
| InChIKey | OMOGRPRLOQNMPP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |