About 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane
2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane (PubChem CID 54159215) has the molecular formula C24H46O3
and a molecular weight of 382.63 g/mol. Its IUPAC name is 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane |
| PubChem CID | 54159215 |
| Molecular Formula | C24H46O3 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.34 |
| IUPAC Name | 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane |
| SMILES | CCCCCCCCC=CCCCCCCCCOCC1COC(C)(C)O1 |
| InChI | InChI=1S/C24H46O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-21-23-22-26-24(2,3)27-23/h11-12,23H,4-10,13-22H2,1-3H3 |
| InChIKey | ONGCAPZNZXGPGB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane?
The IUPAC name of 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane (CID 54159215) is 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane.
What is the SMILES notation for 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane?
The canonical SMILES for 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane is CCCCCCCCC=CCCCCCCCCOCC1COC(C)(C)O1.
What is the InChIKey of 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane?
The InChIKey is ONGCAPZNZXGPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-21-23-22-26-24(2,3)27-23/h11-12,23H,4-10,13-22H2,1-3H3.
What are the key properties of 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane?
2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane has a molecular weight of 382.63 g/mol, XLogP of 7.19, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-(octadec-9-enoxymethyl)-1,3-dioxolane is sourced from PubChem (CID 54159215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).