C9H16N2O5S — CID 54159428
methyl (2S)-1-(2-aminoethylsulfanylcarbonyl)-2,4-dihydroxypyrrolidine-2-carboxylate (PubChem CID 54159428) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is methyl (2S)-1-(2-aminoethylsulfanylcarbonyl)-2,4-dihydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(2-aminoethylsulfanylcarbonyl)-2,4-dihydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54159428 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | methyl (2S)-1-(2-aminoethylsulfanylcarbonyl)-2,4-dihydroxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@]1(O)CC(O)CN1C(=O)SCCN |
| InChI | InChI=1S/C9H16N2O5S/c1-16-7(13)9(15)4-6(12)5-11(9)8(14)17-3-2-10/h6,12,15H,2-5,10H2,1H3/t6?,9-/m0/s1 |
| InChIKey | ONJPRYLBVHNMTH-HSOSERFQSA-N |
| XLogP | -1.27 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|