C25H26N2O4 — CID 54159517
6-[(3,3-dihydroxy-2-methylpropyl)amino]-2-(2,4-dimethylphenyl)-5-methylbenzo[de]isoquinoline-1,3-dione (PubChem CID 54159517) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 6-[(3,3-dihydroxy-2-methylpropyl)amino]-2-(2,4-dimethylphenyl)-5-methylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[(3,3-dihydroxy-2-methylpropyl)amino]-2-(2,4-dimethylphenyl)-5-methylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 54159517 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 6-[(3,3-dihydroxy-2-methylpropyl)amino]-2-(2,4-dimethylphenyl)-5-methylbenzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3cccc4c(NCC(C)C(O)O)c(C)cc(c34)C2=O)c(C)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-13-8-9-20(14(2)10-13)27-23(28)18-7-5-6-17-21(18)19(24(27)29)11-15(3)22(17)26-12-16(4)25(30)31/h5-11,16,25-26,30-31H,12H2,1-4H3 |
| InChIKey | ONLIGEBDCHYDBK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|